C22H17NO4S — CID 108618757
4-hydroxy-1-(2-hydroxyphenyl)-2-(3-methylphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 108618757) has the molecular formula C22H17NO4S and a molecular weight of 391.45 g/mol. Its IUPAC name is 4-hydroxy-1-(2-hydroxyphenyl)-2-(3-methylphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(2-hydroxyphenyl)-2-(3-methylphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108618757 |
| Molecular Formula | C22H17NO4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 4-hydroxy-1-(2-hydroxyphenyl)-2-(3-methylphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | Cc1cccc(C2C(C(=O)c3cccs3)=C(O)C(=O)N2c2ccccc2O)c1 |
| InChI | InChI=1S/C22H17NO4S/c1-13-6-4-7-14(12-13)19-18(20(25)17-10-5-11-28-17)21(26)22(27)23(19)15-8-2-3-9-16(15)24/h2-12,19,24,26H,1H3 |
| InChIKey | LCFDYENMSFIBAT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |