C27H20N2O5 — CID 108603797
(4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(2-hydroxyphenyl)-5-(1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108603797) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(2-hydroxyphenyl)-5-(1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(2-hydroxyphenyl)-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108603797 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(2-hydroxyphenyl)-5-(1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccccc2O)C(c2c[nH]c3ccccc23)/C1=C(\O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C27H20N2O5/c30-21-8-4-3-7-20(21)29-24(18-14-28-19-6-2-1-5-17(18)19)23(26(32)27(29)33)25(31)16-9-10-22-15(13-16)11-12-34-22/h1-10,13-14,24,28,30-31H,11-12H2/b25-23+ |
| InChIKey | YFKRPGUTTFXTPD-WJTDDFOZSA-N |
| XLogP | 4.43 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|