C26H21NO6 — CID 108647397
(4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-(2-hydroxyphenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108647397) has the molecular formula C26H21NO6 and a molecular weight of 443.46 g/mol. Its IUPAC name is (4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-(2-hydroxyphenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-(2-hydroxyphenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108647397 |
| Molecular Formula | C26H21NO6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (4Z)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-1-(2-hydroxyphenyl)-5-(3-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccccc2O)C(c2cccc(O)c2)/C1=C(/O)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C26H21NO6/c28-18-7-3-5-16(14-18)23-22(24(30)17-10-11-21-15(13-17)6-4-12-33-21)25(31)26(32)27(23)19-8-1-2-9-20(19)29/h1-3,5,7-11,13-14,23,28-30H,4,6,12H2/b24-22- |
| InChIKey | AFHUCGKHOQPTKT-GYHWCHFESA-N |
| XLogP | 4.05 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|