C25H19ClN2O5 — CID 108592000
(4Z)-1-(5-chloro-2-hydroxyphenyl)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108592000) has the molecular formula C25H19ClN2O5 and a molecular weight of 462.89 g/mol. Its IUPAC name is (4Z)-1-(5-chloro-2-hydroxyphenyl)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(5-chloro-2-hydroxyphenyl)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108592000 |
| Molecular Formula | C25H19ClN2O5 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (4Z)-1-(5-chloro-2-hydroxyphenyl)-4-[3,4-dihydro-2H-chromen-6-yl(hydroxy)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cc(Cl)ccc2O)C(c2cccnc2)/C1=C(/O)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C25H19ClN2O5/c26-17-6-7-19(29)18(12-17)28-22(16-3-1-9-27-13-16)21(24(31)25(28)32)23(30)15-5-8-20-14(11-15)4-2-10-33-20/h1,3,5-9,11-13,22,29-30H,2,4,10H2/b23-21- |
| InChIKey | NHABUXLWKKSKHG-LNVKXUELSA-N |
| XLogP | 4.39 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|