C22H14ClN3O6 — CID 108591966
(4E)-1-(5-chloro-2-hydroxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108591966) has the molecular formula C22H14ClN3O6 and a molecular weight of 451.82 g/mol. Its IUPAC name is (4E)-1-(5-chloro-2-hydroxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-chloro-2-hydroxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108591966 |
| Molecular Formula | C22H14ClN3O6 |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | (4E)-1-(5-chloro-2-hydroxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cc(Cl)ccc2O)C(c2cccnc2)/C1=C(\O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H14ClN3O6/c23-14-5-8-17(27)16(10-14)25-19(13-2-1-9-24-11-13)18(21(29)22(25)30)20(28)12-3-6-15(7-4-12)26(31)32/h1-11,19,27-28H/b20-18+ |
| InChIKey | NJBZFRISNCBAMK-CZIZESTLSA-N |
| XLogP | 3.98 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|