C23H14N4O5 — CID 108630346
4-[(4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzonitrile (PubChem CID 108630346) has the molecular formula C23H14N4O5 and a molecular weight of 426.39 g/mol. Its IUPAC name is 4-[(4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108630346 |
| Molecular Formula | C23H14N4O5 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 4-[(4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc([N+](=O)[O-])cc3)C2c2cccnc2)cc1 |
| InChI | InChI=1S/C23H14N4O5/c24-12-14-3-7-17(8-4-14)26-20(16-2-1-11-25-13-16)19(22(29)23(26)30)21(28)15-5-9-18(10-6-15)27(31)32/h1-11,13,20,28H/b21-19- |
| InChIKey | GBPMANLESLYCQM-VZCXRCSSSA-N |
| XLogP | 3.49 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|