C27H24N4O5 — CID 108672964
(4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-(4-piperidin-1-ylphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108672964) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is (4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-(4-piperidin-1-ylphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-(4-piperidin-1-ylphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108672964 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (4Z)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-(4-piperidin-1-ylphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(N3CCCCC3)cc2)C(c2cccnc2)/C1=C(/O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H24N4O5/c32-25(18-6-8-22(9-7-18)31(35)36)23-24(19-5-4-14-28-17-19)30(27(34)26(23)33)21-12-10-20(11-13-21)29-15-2-1-3-16-29/h4-14,17,24,32H,1-3,15-16H2/b25-23- |
| InChIKey | JYAJKILJQCOWQA-BZZOAKBMSA-N |
| XLogP | 4.61 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|