C29H29N3O5 — CID 108672989
(4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-1-(4-piperidin-1-ylphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108672989) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is (4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-1-(4-piperidin-1-ylphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-1-(4-piperidin-1-ylphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108672989 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | (4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-1-(4-piperidin-1-ylphenyl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | COc1cccc(OC)c1/C(O)=C1\C(=O)C(=O)N(c2ccc(N3CCCCC3)cc2)C1c1cccnc1 |
| InChI | InChI=1S/C29H29N3O5/c1-36-22-9-6-10-23(37-2)24(22)27(33)25-26(19-8-7-15-30-18-19)32(29(35)28(25)34)21-13-11-20(12-14-21)31-16-4-3-5-17-31/h6-15,18,26,33H,3-5,16-17H2,1-2H3/b27-25+ |
| InChIKey | JWKZHNMKAMWPGD-IMVLJIQESA-N |
| XLogP | 4.72 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|