C26H19ClN2O3 — CID 108603934
(4E)-4-[(3-chlorophenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)-1-(2-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108603934) has the molecular formula C26H19ClN2O3 and a molecular weight of 442.90 g/mol. Its IUPAC name is (4E)-4-[(3-chlorophenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)-1-(2-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-chlorophenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)-1-(2-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108603934 |
| Molecular Formula | C26H19ClN2O3 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (4E)-4-[(3-chlorophenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)-1-(2-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccccc1N1C(=O)C(=O)/C(=C(/O)c2cccc(Cl)c2)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H19ClN2O3/c1-15-7-2-5-12-21(15)29-23(19-14-28-20-11-4-3-10-18(19)20)22(25(31)26(29)32)24(30)16-8-6-9-17(27)13-16/h2-14,23,28,30H,1H3/b24-22+ |
| InChIKey | ZBJJEAKQKJZUMT-ZNTNEXAZSA-N |
| XLogP | 5.76 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|