C29H25N3O4 — CID 108605680
(4E)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-(1-methylindol-3-yl)-1-phenylpyrrolidine-2,3-dione (PubChem CID 108605680) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-(1-methylindol-3-yl)-1-phenylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-(1-methylindol-3-yl)-1-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108605680 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (4E)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-(1-methylindol-3-yl)-1-phenylpyrrolidine-2,3-dione |
| SMILES | CN1CCOc2ccc(/C(O)=C3\C(=O)C(=O)N(c4ccccc4)C3c3cn(C)c4ccccc34)cc21 |
| InChI | InChI=1S/C29H25N3O4/c1-30-14-15-36-24-13-12-18(16-23(24)30)27(33)25-26(21-17-31(2)22-11-7-6-10-20(21)22)32(29(35)28(25)34)19-8-4-3-5-9-19/h3-13,16-17,26,33H,14-15H2,1-2H3/b27-25+ |
| InChIKey | GEJXNMSDCKONNO-IMVLJIQESA-N |
| XLogP | 4.63 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|