C22H22N2O4S — CID 108605815
4-hydroxy-1-(3-methoxypropyl)-2-(1-methylindol-3-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 108605815) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 4-hydroxy-1-(3-methoxypropyl)-2-(1-methylindol-3-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(3-methoxypropyl)-2-(1-methylindol-3-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108605815 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-hydroxy-1-(3-methoxypropyl)-2-(1-methylindol-3-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | COCCCN1C(=O)C(O)=C(C(=O)c2cccs2)C1c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C22H22N2O4S/c1-23-13-15(14-7-3-4-8-16(14)23)19-18(20(25)17-9-5-12-29-17)21(26)22(27)24(19)10-6-11-28-2/h3-5,7-9,12-13,19,26H,6,10-11H2,1-2H3 |
| InChIKey | DPQQJUYZLZJKIE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|