C18H16INO4S — CID 40928181
(2R)-4-hydroxy-2-(4-iodophenyl)-1-(2-methoxyethyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 40928181) has the molecular formula C18H16INO4S and a molecular weight of 469.30 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-(4-iodophenyl)-1-(2-methoxyethyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | (2R)-4-hydroxy-2-(4-iodophenyl)-1-(2-methoxyethyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 40928181 |
| Molecular Formula | C18H16INO4S |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | (2R)-4-hydroxy-2-(4-iodophenyl)-1-(2-methoxyethyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | COCCN1C(=O)C(O)=C(C(=O)c2cccs2)[C@H]1c1ccc(I)cc1 |
| InChI | InChI=1S/C18H16INO4S/c1-24-9-8-20-15(11-4-6-12(19)7-5-11)14(17(22)18(20)23)16(21)13-3-2-10-25-13/h2-7,10,15,22H,8-9H2,1H3/t15-/m1/s1 |
| InChIKey | ZUFXNCZRJIUNMA-OAHLLOKOSA-N |
| XLogP | 3.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|