C21H21NO7S — CID 41065435
methyl 4-[(2S)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-2-yl]benzoate (PubChem CID 41065435) has the molecular formula C21H21NO7S and a molecular weight of 431.47 g/mol. Its IUPAC name is methyl 4-[(2S)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-2-yl]benzoate |
|---|---|
| PubChem CID | 41065435 |
| Molecular Formula | C21H21NO7S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | methyl 4-[(2S)-4-hydroxy-1-[2-(2-hydroxyethoxy)ethyl]-5-oxo-3-(thiophene-2-carbonyl)-2H-pyrrol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C(C(=O)c3cccs3)=C(O)C(=O)N2CCOCCO)cc1 |
| InChI | InChI=1S/C21H21NO7S/c1-28-21(27)14-6-4-13(5-7-14)17-16(18(24)15-3-2-12-30-15)19(25)20(26)22(17)8-10-29-11-9-23/h2-7,12,17,23,25H,8-11H2,1H3/t17-/m0/s1 |
| InChIKey | XNGSMRVCBRNQCC-KRWDZBQOSA-N |
| XLogP | 2.12 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|