C22H16INO3S — CID 3384698
1-benzyl-4-hydroxy-2-(4-iodophenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3384698) has the molecular formula C22H16INO3S and a molecular weight of 501.35 g/mol. Its IUPAC name is 1-benzyl-4-hydroxy-2-(4-iodophenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-benzyl-4-hydroxy-2-(4-iodophenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3384698 |
| Molecular Formula | C22H16INO3S |
| Molecular Weight | 501.35 g/mol |
| Exact Mass | 500.99 |
| IUPAC Name | 1-benzyl-4-hydroxy-2-(4-iodophenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(Cc2ccccc2)C1c1ccc(I)cc1)c1cccs1 |
| InChI | InChI=1S/C22H16INO3S/c23-16-10-8-15(9-11-16)19-18(20(25)17-7-4-12-28-17)21(26)22(27)24(19)13-14-5-2-1-3-6-14/h1-12,19,26H,13H2 |
| InChIKey | HBGRRLSRXWDOLR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|