C29H23NO4S — CID 3368444
1-benzyl-4-hydroxy-2-(3-phenylmethoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3368444) has the molecular formula C29H23NO4S and a molecular weight of 481.57 g/mol. Its IUPAC name is 1-benzyl-4-hydroxy-2-(3-phenylmethoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 1-benzyl-4-hydroxy-2-(3-phenylmethoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3368444 |
| Molecular Formula | C29H23NO4S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 1-benzyl-4-hydroxy-2-(3-phenylmethoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(Cc2ccccc2)C1c1cccc(OCc2ccccc2)c1)c1cccs1 |
| InChI | InChI=1S/C29H23NO4S/c31-27(24-15-8-16-35-24)25-26(30(29(33)28(25)32)18-20-9-3-1-4-10-20)22-13-7-14-23(17-22)34-19-21-11-5-2-6-12-21/h1-17,26,32H,18-19H2 |
| InChIKey | QVEQBVJAFAIUDL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |