C26H25NO4S — CID 3255191
4-hydroxy-1-(2-phenylethyl)-2-(3-propoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3255191) has the molecular formula C26H25NO4S and a molecular weight of 447.56 g/mol. Its IUPAC name is 4-hydroxy-1-(2-phenylethyl)-2-(3-propoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(2-phenylethyl)-2-(3-propoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3255191 |
| Molecular Formula | C26H25NO4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-hydroxy-1-(2-phenylethyl)-2-(3-propoxyphenyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | CCCOc1cccc(C2C(C(=O)c3cccs3)=C(O)C(=O)N2CCc2ccccc2)c1 |
| InChI | InChI=1S/C26H25NO4S/c1-2-15-31-20-11-6-10-19(17-20)23-22(24(28)21-12-7-16-32-21)25(29)26(30)27(23)14-13-18-8-4-3-5-9-18/h3-12,16-17,23,29H,2,13-15H2,1H3 |
| InChIKey | NUYCTPMGCSXLTP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |