C23H18INO3S — CID 3401029
4-hydroxy-2-(4-iodophenyl)-1-(2-phenylethyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 3401029) has the molecular formula C23H18INO3S and a molecular weight of 515.37 g/mol. Its IUPAC name is 4-hydroxy-2-(4-iodophenyl)-1-(2-phenylethyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(4-iodophenyl)-1-(2-phenylethyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3401029 |
| Molecular Formula | C23H18INO3S |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | 4-hydroxy-2-(4-iodophenyl)-1-(2-phenylethyl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(CCc2ccccc2)C1c1ccc(I)cc1)c1cccs1 |
| InChI | InChI=1S/C23H18INO3S/c24-17-10-8-16(9-11-17)20-19(21(26)18-7-4-14-29-18)22(27)23(28)25(20)13-12-15-5-2-1-3-6-15/h1-11,14,20,27H,12-13H2 |
| InChIKey | HCQSLFQDRMZBAQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|