C24H19NO7 — CID 108607465
methyl 3-[(3Z)-2-(furan-2-yl)-3-[hydroxy-(2-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108607465) has the molecular formula C24H19NO7 and a molecular weight of 433.42 g/mol. Its IUPAC name is methyl 3-[(3Z)-2-(furan-2-yl)-3-[hydroxy-(2-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 3-[(3Z)-2-(furan-2-yl)-3-[hydroxy-(2-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108607465 |
| Molecular Formula | C24H19NO7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | methyl 3-[(3Z)-2-(furan-2-yl)-3-[hydroxy-(2-methoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3ccccc3OC)C2c2ccco2)c1 |
| InChI | InChI=1S/C24H19NO7/c1-30-17-10-4-3-9-16(17)21(26)19-20(18-11-6-12-32-18)25(23(28)22(19)27)15-8-5-7-14(13-15)24(29)31-2/h3-13,20,26H,1-2H3/b21-19- |
| InChIKey | SPDAGJALPQTUFE-VZCXRCSSSA-N |
| XLogP | 3.70 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|