C23H16FNO6 — CID 108607335
methyl 4-[(3Z)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108607335) has the molecular formula C23H16FNO6 and a molecular weight of 421.38 g/mol. Its IUPAC name is methyl 4-[(3Z)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3Z)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108607335 |
| Molecular Formula | C23H16FNO6 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | methyl 4-[(3Z)-3-[(4-fluorophenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(F)cc3)C2c2ccco2)cc1 |
| InChI | InChI=1S/C23H16FNO6/c1-30-23(29)14-6-10-16(11-7-14)25-19(17-3-2-12-31-17)18(21(27)22(25)28)20(26)13-4-8-15(24)9-5-13/h2-12,19,26H,1H3/b20-18- |
| InChIKey | AIQKOFWHNISMGF-ZZEZOPTASA-N |
| XLogP | 3.83 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|