C23H15Cl2NO6 — CID 108607338
methyl 4-[(3Z)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108607338) has the molecular formula C23H15Cl2NO6 and a molecular weight of 472.28 g/mol. Its IUPAC name is methyl 4-[(3Z)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3Z)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108607338 |
| Molecular Formula | C23H15Cl2NO6 |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | methyl 4-[(3Z)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(Cl)c(Cl)c3)C2c2ccco2)cc1 |
| InChI | InChI=1S/C23H15Cl2NO6/c1-31-23(30)12-4-7-14(8-5-12)26-19(17-3-2-10-32-17)18(21(28)22(26)29)20(27)13-6-9-15(24)16(25)11-13/h2-11,19,27H,1H3/b20-18- |
| InChIKey | WPGPVEYLCBVJPS-ZZEZOPTASA-N |
| XLogP | 5.00 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|