C25H20ClNO7 — CID 108607310
methyl 4-[(3Z)-3-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108607310) has the molecular formula C25H20ClNO7 and a molecular weight of 481.89 g/mol. Its IUPAC name is methyl 4-[(3Z)-3-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3Z)-3-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108607310 |
| Molecular Formula | C25H20ClNO7 |
| Molecular Weight | 481.89 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | methyl 4-[(3Z)-3-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-2-(furan-2-yl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOc1cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C(=O)OC)cc3)C2c2ccco2)ccc1Cl |
| InChI | InChI=1S/C25H20ClNO7/c1-3-33-19-13-15(8-11-17(19)26)22(28)20-21(18-5-4-12-34-18)27(24(30)23(20)29)16-9-6-14(7-10-16)25(31)32-2/h4-13,21,28H,3H2,1-2H3/b22-20- |
| InChIKey | PTEMKCYZQIJTMC-XDOYNYLZSA-N |
| XLogP | 4.74 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|