C23H17N3O7 — CID 108608025
N-[3-[(3Z)-2-(furan-2-yl)-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108608025) has the molecular formula C23H17N3O7 and a molecular weight of 447.40 g/mol. Its IUPAC name is N-[3-[(3Z)-2-(furan-2-yl)-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[(3Z)-2-(furan-2-yl)-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108608025 |
| Molecular Formula | C23H17N3O7 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-[3-[(3Z)-2-(furan-2-yl)-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(N2C(=O)C(=O)/C(=C(\O)c3cccc([N+](=O)[O-])c3)C2c2ccco2)c1 |
| InChI | InChI=1S/C23H17N3O7/c1-13(27)24-15-6-3-7-16(12-15)25-20(18-9-4-10-33-18)19(22(29)23(25)30)21(28)14-5-2-8-17(11-14)26(31)32/h2-12,20,28H,1H3,(H,24,27)/b21-19- |
| InChIKey | YAFPLOJGJIBFRB-VZCXRCSSSA-N |
| XLogP | 3.77 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|