C21H13ClN2O6 — CID 108654713
(4Z)-1-(4-chlorophenyl)-5-(furan-2-yl)-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108654713) has the molecular formula C21H13ClN2O6 and a molecular weight of 424.80 g/mol. Its IUPAC name is (4Z)-1-(4-chlorophenyl)-5-(furan-2-yl)-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(4-chlorophenyl)-5-(furan-2-yl)-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108654713 |
| Molecular Formula | C21H13ClN2O6 |
| Molecular Weight | 424.80 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | (4Z)-1-(4-chlorophenyl)-5-(furan-2-yl)-4-[hydroxy-(3-nitrophenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(Cl)cc2)C(c2ccco2)/C1=C(/O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H13ClN2O6/c22-13-6-8-14(9-7-13)23-18(16-5-2-10-30-16)17(20(26)21(23)27)19(25)12-3-1-4-15(11-12)24(28)29/h1-11,18,25H/b19-17- |
| InChIKey | KNWAOMAYGIWBJY-ZPHPHTNESA-N |
| XLogP | 4.47 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|