C23H18ClNO4 — CID 108608250
(4Z)-1-[2-(4-chlorophenyl)ethyl]-5-(furan-2-yl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108608250) has the molecular formula C23H18ClNO4 and a molecular weight of 407.85 g/mol. Its IUPAC name is (4Z)-1-[2-(4-chlorophenyl)ethyl]-5-(furan-2-yl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[2-(4-chlorophenyl)ethyl]-5-(furan-2-yl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108608250 |
| Molecular Formula | C23H18ClNO4 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (4Z)-1-[2-(4-chlorophenyl)ethyl]-5-(furan-2-yl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCc2ccc(Cl)cc2)C(c2ccco2)/C1=C(/O)c1ccccc1 |
| InChI | InChI=1S/C23H18ClNO4/c24-17-10-8-15(9-11-17)12-13-25-20(18-7-4-14-29-18)19(22(27)23(25)28)21(26)16-5-2-1-3-6-16/h1-11,14,20,26H,12-13H2/b21-19- |
| InChIKey | RFJFTYNFWKGXRV-VZCXRCSSSA-N |
| XLogP | 4.60 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|