C25H19NO8 — CID 108609209
(4Z)-1-(1,3-benzodioxol-5-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(5-methylfuran-2-yl)pyrrolidine-2,3-dione (PubChem CID 108609209) has the molecular formula C25H19NO8 and a molecular weight of 461.43 g/mol. Its IUPAC name is (4Z)-1-(1,3-benzodioxol-5-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(5-methylfuran-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(1,3-benzodioxol-5-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(5-methylfuran-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108609209 |
| Molecular Formula | C25H19NO8 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | (4Z)-1-(1,3-benzodioxol-5-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(5-methylfuran-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C2/C(=C(/O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C25H19NO8/c1-13-2-5-18(34-13)22-21(23(27)14-3-6-16-19(10-14)31-9-8-30-16)24(28)25(29)26(22)15-4-7-17-20(11-15)33-12-32-17/h2-7,10-11,22,27H,8-9,12H2,1H3/b23-21- |
| InChIKey | BOMSWQSAZXWPMI-LNVKXUELSA-N |
| XLogP | 3.71 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|