C19H29N3O3 — CID 10860962
tert-butyl N-[(2S,3R,4E)-3-hydroxy-1-phenyl-4-pyrrolidin-1-yliminobutan-2-yl]carbamate (PubChem CID 10860962) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4E)-3-hydroxy-1-phenyl-4-pyrrolidin-1-yliminobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4E)-3-hydroxy-1-phenyl-4-pyrrolidin-1-yliminobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10860962 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl N-[(2S,3R,4E)-3-hydroxy-1-phenyl-4-pyrrolidin-1-yliminobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)/C=N/N1CCCC1 |
| InChI | InChI=1S/C19H29N3O3/c1-19(2,3)25-18(24)21-16(13-15-9-5-4-6-10-15)17(23)14-20-22-11-7-8-12-22/h4-6,9-10,14,16-17,23H,7-8,11-13H2,1-3H3,(H,21,24)/b20-14+/t16-,17-/m0/s1 |
| InChIKey | YVXMSUMPULNDOZ-NQNPOAHASA-N |
| XLogP | 2.56 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|