C23H17Cl2NO4S — CID 108610462
(4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108610462) has the molecular formula C23H17Cl2NO4S and a molecular weight of 474.37 g/mol. Its IUPAC name is (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108610462 |
| Molecular Formula | C23H17Cl2NO4S |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(Cl)c(Cl)c3)C2c2sccc2C)cc1 |
| InChI | InChI=1S/C23H17Cl2NO4S/c1-12-9-10-31-22(12)19-18(20(27)13-3-8-16(24)17(25)11-13)21(28)23(29)26(19)14-4-6-15(30-2)7-5-14/h3-11,19,27H,1-2H3/b20-18- |
| InChIKey | BLBZDJDSVWGWQE-ZZEZOPTASA-N |
| XLogP | 6.00 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|