C24H19Cl2NO5S — CID 108687035
(4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(3,4-dimethoxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108687035) has the molecular formula C24H19Cl2NO5S and a molecular weight of 504.39 g/mol. Its IUPAC name is (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(3,4-dimethoxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(3,4-dimethoxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108687035 |
| Molecular Formula | C24H19Cl2NO5S |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | (4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(3,4-dimethoxyphenyl)-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc(Cl)c(Cl)c3)C2c2sccc2C)cc1OC |
| InChI | InChI=1S/C24H19Cl2NO5S/c1-12-8-9-33-23(12)20-19(21(28)13-4-6-15(25)16(26)10-13)22(29)24(30)27(20)14-5-7-17(31-2)18(11-14)32-3/h4-11,20,28H,1-3H3/b21-19- |
| InChIKey | FEJBRMMPNMIHOU-VZCXRCSSSA-N |
| XLogP | 6.01 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|