C19H20N4OS — CID 10861123
3-(phenoxymethyl)-6-[(1S)-1-phenylethyl]-5,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,5]thiadiazine (PubChem CID 10861123) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-(phenoxymethyl)-6-[(1S)-1-phenylethyl]-5,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,5]thiadiazine.
| Compound Name | 3-(phenoxymethyl)-6-[(1S)-1-phenylethyl]-5,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,5]thiadiazine |
|---|---|
| PubChem CID | 10861123 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 3-(phenoxymethyl)-6-[(1S)-1-phenylethyl]-5,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,5]thiadiazine |
| SMILES | C[C@@H](c1ccccc1)N1CSc2nnc(COc3ccccc3)n2C1 |
| InChI | InChI=1S/C19H20N4OS/c1-15(16-8-4-2-5-9-16)22-13-23-18(20-21-19(23)25-14-22)12-24-17-10-6-3-7-11-17/h2-11,15H,12-14H2,1H3/t15-/m0/s1 |
| InChIKey | ZWCBGCPCRVMFOM-HNNXBMFYSA-N |
| XLogP | 3.94 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |