C26H29NO7 — CID 108611250
[3-[(3Z)-3-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108611250) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is [3-[(3Z)-3-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [3-[(3Z)-3-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108611250 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | [3-[(3Z)-3-[hydroxy-(4-propan-2-yloxyphenyl)methylidene]-1-(3-methoxypropyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | COCCCN1C(=O)C(=O)/C(=C(\O)c2ccc(OC(C)C)cc2)C1c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C26H29NO7/c1-16(2)33-20-11-9-18(10-12-20)24(29)22-23(19-7-5-8-21(15-19)34-17(3)28)27(13-6-14-32-4)26(31)25(22)30/h5,7-12,15-16,23,29H,6,13-14H2,1-4H3/b24-22- |
| InChIKey | FROYJINPVMLLOM-GYHWCHFESA-N |
| XLogP | 3.86 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|