C22H20BrNO6 — CID 108663626
[3-[(3Z)-3-[(4-bromophenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108663626) has the molecular formula C22H20BrNO6 and a molecular weight of 474.31 g/mol. Its IUPAC name is [3-[(3Z)-3-[(4-bromophenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [3-[(3Z)-3-[(4-bromophenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108663626 |
| Molecular Formula | C22H20BrNO6 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | [3-[(3Z)-3-[(4-bromophenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | COCCN1C(=O)C(=O)/C(=C(\O)c2ccc(Br)cc2)C1c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C22H20BrNO6/c1-13(25)30-17-5-3-4-15(12-17)19-18(20(26)14-6-8-16(23)9-7-14)21(27)22(28)24(19)10-11-29-2/h3-9,12,19,26H,10-11H2,1-2H3/b20-18- |
| InChIKey | YMPQMSIJSXOTBF-ZZEZOPTASA-N |
| XLogP | 3.44 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|