C24H25NO8 — CID 108663617
[3-[(3Z)-3-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108663617) has the molecular formula C24H25NO8 and a molecular weight of 455.46 g/mol. Its IUPAC name is [3-[(3Z)-3-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [3-[(3Z)-3-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108663617 |
| Molecular Formula | C24H25NO8 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | [3-[(3Z)-3-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | COCCN1C(=O)C(=O)/C(=C(\O)c2ccc(OC)cc2OC)C1c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C24H25NO8/c1-14(26)33-17-7-5-6-15(12-17)21-20(23(28)24(29)25(21)10-11-30-2)22(27)18-9-8-16(31-3)13-19(18)32-4/h5-9,12-13,21,27H,10-11H2,1-4H3/b22-20- |
| InChIKey | HODWGTSWWCAVAT-XDOYNYLZSA-N |
| XLogP | 2.70 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|