C12H17F6O3P — CID 10861149
[(Z)-2-[bis(2,2,2-trifluoroethoxy)phosphoryl]ethenyl]cyclohexane (PubChem CID 10861149) has the molecular formula C12H17F6O3P and a molecular weight of 354.23 g/mol. Its IUPAC name is [(Z)-2-[bis(2,2,2-trifluoroethoxy)phosphoryl]ethenyl]cyclohexane.
| Compound Name | [(Z)-2-[bis(2,2,2-trifluoroethoxy)phosphoryl]ethenyl]cyclohexane |
|---|---|
| PubChem CID | 10861149 |
| Molecular Formula | C12H17F6O3P |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [(Z)-2-[bis(2,2,2-trifluoroethoxy)phosphoryl]ethenyl]cyclohexane |
| SMILES | O=P(/C=C\C1CCCCC1)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C12H17F6O3P/c13-11(14,15)8-20-22(19,21-9-12(16,17)18)7-6-10-4-2-1-3-5-10/h6-7,10H,1-5,8-9H2/b7-6- |
| InChIKey | NGAQEADGPOCRPB-SREVYHEPSA-N |
| XLogP | 5.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|