C16H15F3O4S — CID 10861309
[(1S)-2,2,2-trifluoro-1-phenylmethoxyethyl] 4-methylbenzenesulfonate (PubChem CID 10861309) has the molecular formula C16H15F3O4S and a molecular weight of 360.35 g/mol. Its IUPAC name is [(1S)-2,2,2-trifluoro-1-phenylmethoxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S)-2,2,2-trifluoro-1-phenylmethoxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10861309 |
| Molecular Formula | C16H15F3O4S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [(1S)-2,2,2-trifluoro-1-phenylmethoxyethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H](OCc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3O4S/c1-12-7-9-14(10-8-12)24(20,21)23-15(16(17,18)19)22-11-13-5-3-2-4-6-13/h2-10,15H,11H2,1H3/t15-/m0/s1 |
| InChIKey | GDRBHDMZOBCCEO-HNNXBMFYSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|