C27H27NO5 — CID 108615310
(4E)-1-butyl-5-(2,3-dimethoxyphenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108615310) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is (4E)-1-butyl-5-(2,3-dimethoxyphenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-butyl-5-(2,3-dimethoxyphenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108615310 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (4E)-1-butyl-5-(2,3-dimethoxyphenyl)-4-[hydroxy(naphthalen-1-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCN1C(=O)C(=O)/C(=C(/O)c2cccc3ccccc23)C1c1cccc(OC)c1OC |
| InChI | InChI=1S/C27H27NO5/c1-4-5-16-28-23(20-14-9-15-21(32-2)26(20)33-3)22(25(30)27(28)31)24(29)19-13-8-11-17-10-6-7-12-18(17)19/h6-15,23,29H,4-5,16H2,1-3H3/b24-22+ |
| InChIKey | ZFJFXKDETSFAJS-ZNTNEXAZSA-N |
| XLogP | 5.08 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|