C26H25NO3 — CID 108620013
(4Z)-1-butyl-4-[hydroxy(naphthalen-1-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108620013) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is (4Z)-1-butyl-4-[hydroxy(naphthalen-1-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-butyl-4-[hydroxy(naphthalen-1-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108620013 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (4Z)-1-butyl-4-[hydroxy(naphthalen-1-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCN1C(=O)C(=O)/C(=C(\O)c2cccc3ccccc23)C1c1cccc(C)c1 |
| InChI | InChI=1S/C26H25NO3/c1-3-4-15-27-23(19-12-7-9-17(2)16-19)22(25(29)26(27)30)24(28)21-14-8-11-18-10-5-6-13-20(18)21/h5-14,16,23,28H,3-4,15H2,1-2H3/b24-22- |
| InChIKey | FLMYJLIEAHYQKP-GYHWCHFESA-N |
| XLogP | 5.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|