C24H23BrN2O4 — CID 108615907
3-(5-bromo-1-benzofuran-2-carbonyl)-2-[4-(dimethylamino)phenyl]-4-hydroxy-1-propyl-2H-pyrrol-5-one (PubChem CID 108615907) has the molecular formula C24H23BrN2O4 and a molecular weight of 483.36 g/mol. Its IUPAC name is 3-(5-bromo-1-benzofuran-2-carbonyl)-2-[4-(dimethylamino)phenyl]-4-hydroxy-1-propyl-2H-pyrrol-5-one.
| Compound Name | 3-(5-bromo-1-benzofuran-2-carbonyl)-2-[4-(dimethylamino)phenyl]-4-hydroxy-1-propyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108615907 |
| Molecular Formula | C24H23BrN2O4 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 3-(5-bromo-1-benzofuran-2-carbonyl)-2-[4-(dimethylamino)phenyl]-4-hydroxy-1-propyl-2H-pyrrol-5-one |
| SMILES | CCCN1C(=O)C(O)=C(C(=O)c2cc3cc(Br)ccc3o2)C1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C24H23BrN2O4/c1-4-11-27-21(14-5-8-17(9-6-14)26(2)3)20(23(29)24(27)30)22(28)19-13-15-12-16(25)7-10-18(15)31-19/h5-10,12-13,21,29H,4,11H2,1-3H3 |
| InChIKey | HPBBLMJHTYJOMP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|