C26H27BrN2O4 — CID 108618224
3-(5-bromo-1-benzofuran-2-carbonyl)-2-[4-(diethylamino)phenyl]-4-hydroxy-1-propyl-2H-pyrrol-5-one (PubChem CID 108618224) has the molecular formula C26H27BrN2O4 and a molecular weight of 511.42 g/mol. Its IUPAC name is 3-(5-bromo-1-benzofuran-2-carbonyl)-2-[4-(diethylamino)phenyl]-4-hydroxy-1-propyl-2H-pyrrol-5-one.
| Compound Name | 3-(5-bromo-1-benzofuran-2-carbonyl)-2-[4-(diethylamino)phenyl]-4-hydroxy-1-propyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108618224 |
| Molecular Formula | C26H27BrN2O4 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 3-(5-bromo-1-benzofuran-2-carbonyl)-2-[4-(diethylamino)phenyl]-4-hydroxy-1-propyl-2H-pyrrol-5-one |
| SMILES | CCCN1C(=O)C(O)=C(C(=O)c2cc3cc(Br)ccc3o2)C1c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C26H27BrN2O4/c1-4-13-29-23(16-7-10-19(11-8-16)28(5-2)6-3)22(25(31)26(29)32)24(30)21-15-17-14-18(27)9-12-20(17)33-21/h7-12,14-15,23,31H,4-6,13H2,1-3H3 |
| InChIKey | XXMOUEVFBLAFCB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|