C27H33NO7 — CID 108618003
(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione (PubChem CID 108618003) has the molecular formula C27H33NO7 and a molecular weight of 483.56 g/mol. Its IUPAC name is (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108618003 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(CCCOC(C)C)C2c2ccc(O)cc2)c(OCC)c1 |
| InChI | InChI=1S/C27H33NO7/c1-5-33-20-12-13-21(22(16-20)34-6-2)25(30)23-24(18-8-10-19(29)11-9-18)28(27(32)26(23)31)14-7-15-35-17(3)4/h8-13,16-17,24,29-30H,5-7,14-15H2,1-4H3/b25-23- |
| InChIKey | QIWKEODFGKMCQC-BZZOAKBMSA-N |
| XLogP | 4.43 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|