C24H25Cl2NO3 — CID 108620860
(4Z)-5-(4-tert-butylphenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-propylpyrrolidine-2,3-dione (PubChem CID 108620860) has the molecular formula C24H25Cl2NO3 and a molecular weight of 446.37 g/mol. Its IUPAC name is (4Z)-5-(4-tert-butylphenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-propylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(4-tert-butylphenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-propylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108620860 |
| Molecular Formula | C24H25Cl2NO3 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (4Z)-5-(4-tert-butylphenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-propylpyrrolidine-2,3-dione |
| SMILES | CCCN1C(=O)C(=O)/C(=C(\O)c2ccc(Cl)c(Cl)c2)C1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H25Cl2NO3/c1-5-12-27-20(14-6-9-16(10-7-14)24(2,3)4)19(22(29)23(27)30)21(28)15-8-11-17(25)18(26)13-15/h6-11,13,20,28H,5,12H2,1-4H3/b21-19- |
| InChIKey | OJYZOAXSXLLYJK-VZCXRCSSSA-N |
| XLogP | 6.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|