C29H25Cl2NO5 — CID 108717942
4-[[(3Z)-2-(4-tert-butylphenyl)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 108717942) has the molecular formula C29H25Cl2NO5 and a molecular weight of 538.43 g/mol. Its IUPAC name is 4-[[(3Z)-2-(4-tert-butylphenyl)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3Z)-2-(4-tert-butylphenyl)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 108717942 |
| Molecular Formula | C29H25Cl2NO5 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 4-[[(3Z)-2-(4-tert-butylphenyl)-3-[(3,4-dichlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(C2/C(=C(/O)c3ccc(Cl)c(Cl)c3)C(=O)C(=O)N2Cc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H25Cl2NO5/c1-29(2,3)20-11-8-17(9-12-20)24-23(25(33)19-10-13-21(30)22(31)14-19)26(34)27(35)32(24)15-16-4-6-18(7-5-16)28(36)37/h4-14,24,33H,15H2,1-3H3,(H,36,37)/b25-23- |
| InChIKey | JJWOFVQMOQMBHX-BZZOAKBMSA-N |
| XLogP | 6.61 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|