C27H21Cl2NO5 — CID 108694469
ethyl 4-[[(4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]methyl]benzoate (PubChem CID 108694469) has the molecular formula C27H21Cl2NO5 and a molecular weight of 510.37 g/mol. Its IUPAC name is ethyl 4-[[(4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]methyl]benzoate.
| Compound Name | ethyl 4-[[(4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 108694469 |
| Molecular Formula | C27H21Cl2NO5 |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | ethyl 4-[[(4Z)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN2C(=O)C(=O)/C(=C(\O)c3ccc(Cl)c(Cl)c3)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21Cl2NO5/c1-2-35-27(34)18-10-8-16(9-11-18)15-30-23(17-6-4-3-5-7-17)22(25(32)26(30)33)24(31)19-12-13-20(28)21(29)14-19/h3-14,23,31H,2,15H2,1H3/b24-22- |
| InChIKey | SGBUBFCDGPKKNV-GYHWCHFESA-N |
| XLogP | 5.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|