C30H28ClNO6 — CID 108717928
4-[[(3Z)-2-(4-tert-butylphenyl)-3-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 108717928) has the molecular formula C30H28ClNO6 and a molecular weight of 534.01 g/mol. Its IUPAC name is 4-[[(3Z)-2-(4-tert-butylphenyl)-3-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3Z)-2-(4-tert-butylphenyl)-3-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 108717928 |
| Molecular Formula | C30H28ClNO6 |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 4-[[(3Z)-2-(4-tert-butylphenyl)-3-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(Cc3ccc(C(=O)O)cc3)C2c2ccc(C(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C30H28ClNO6/c1-30(2,3)21-12-9-18(10-13-21)25-24(26(33)20-11-14-23(38-4)22(31)15-20)27(34)28(35)32(25)16-17-5-7-19(8-6-17)29(36)37/h5-15,25,33H,16H2,1-4H3,(H,36,37)/b26-24- |
| InChIKey | MFXHFUUMOFNBPH-LCUIJRPUSA-N |
| XLogP | 5.97 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|