C30H22N2O4S — CID 108623397
4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzonitrile (PubChem CID 108623397) has the molecular formula C30H22N2O4S and a molecular weight of 506.58 g/mol. Its IUPAC name is 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108623397 |
| Molecular Formula | C30H22N2O4S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]benzonitrile |
| SMILES | Cc1cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C#N)cc3)C2c2cccs2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H22N2O4S/c1-19-16-22(11-14-24(19)36-18-21-6-3-2-4-7-21)28(33)26-27(25-8-5-15-37-25)32(30(35)29(26)34)23-12-9-20(17-31)10-13-23/h2-16,27,33H,18H2,1H3/b28-26- |
| InChIKey | CLQWGFFIQOGYRA-SGEDCAFJSA-N |
| XLogP | 6.13 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|