C31H23N3O4 — CID 108630379
4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzonitrile (PubChem CID 108630379) has the molecular formula C31H23N3O4 and a molecular weight of 501.54 g/mol. Its IUPAC name is 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108630379 |
| Molecular Formula | C31H23N3O4 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 4-[(4Z)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]benzonitrile |
| SMILES | Cc1cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C#N)cc3)C2c2cccnc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H23N3O4/c1-20-16-23(11-14-26(20)38-19-22-6-3-2-4-7-22)29(35)27-28(24-8-5-15-33-18-24)34(31(37)30(27)36)25-12-9-21(17-32)10-13-25/h2-16,18,28,35H,19H2,1H3/b29-27- |
| InChIKey | JGFHHPIZAPWBKO-OHYPFYFLSA-N |
| XLogP | 5.47 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|