C24H27NO6S — CID 108623527
(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108623527) has the molecular formula C24H27NO6S and a molecular weight of 457.55 g/mol. Its IUPAC name is (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108623527 |
| Molecular Formula | C24H27NO6S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(oxolan-2-ylmethyl)-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(CC3CCCO3)C2c2cccs2)c(OCC)c1 |
| InChI | InChI=1S/C24H27NO6S/c1-3-29-15-9-10-17(18(13-15)30-4-2)22(26)20-21(19-8-6-12-32-19)25(24(28)23(20)27)14-16-7-5-11-31-16/h6,8-10,12-13,16,21,26H,3-5,7,11,14H2,1-2H3/b22-20- |
| InChIKey | FUDBFILTPVVJAY-XDOYNYLZSA-N |
| XLogP | 4.15 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|