C25H21FN2O4S — CID 108624709
(4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 108624709) has the molecular formula C25H21FN2O4S and a molecular weight of 464.52 g/mol. Its IUPAC name is (4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108624709 |
| Molecular Formula | C25H21FN2O4S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | (4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | CN1CCOc2ccc(/C(O)=C3/C(=O)C(=O)N(Cc4ccc(F)cc4)C3c3cccs3)cc21 |
| InChI | InChI=1S/C25H21FN2O4S/c1-27-10-11-32-19-9-6-16(13-18(19)27)23(29)21-22(20-3-2-12-33-20)28(25(31)24(21)30)14-15-4-7-17(26)8-5-15/h2-9,12-13,22,29H,10-11,14H2,1H3/b23-21- |
| InChIKey | FPQKDQLCAXKZLW-LNVKXUELSA-N |
| XLogP | 4.34 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|