C23H17Cl2N3O4 — CID 108630842
(4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-pyridin-3-yl-1-(pyridin-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108630842) has the molecular formula C23H17Cl2N3O4 and a molecular weight of 470.31 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-pyridin-3-yl-1-(pyridin-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-pyridin-3-yl-1-(pyridin-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108630842 |
| Molecular Formula | C23H17Cl2N3O4 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-pyridin-3-yl-1-(pyridin-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(Cc3ccccn3)C2c2cccnc2)cc1Cl |
| InChI | InChI=1S/C23H17Cl2N3O4/c1-32-22-16(24)9-14(10-17(22)25)20(29)18-19(13-5-4-7-26-11-13)28(23(31)21(18)30)12-15-6-2-3-8-27-15/h2-11,19,29H,12H2,1H3/b20-18+ |
| InChIKey | NVJCZRHGFGGIPK-CZIZESTLSA-N |
| XLogP | 4.41 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|