C28H27ClN2O7 — CID 108702478
(4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(pyridin-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108702478) has the molecular formula C28H27ClN2O7 and a molecular weight of 538.98 g/mol. Its IUPAC name is (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(pyridin-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(pyridin-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108702478 |
| Molecular Formula | C28H27ClN2O7 |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-1-(pyridin-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3cc(C)cc(Cl)c3OC)C(=O)C(=O)N2Cc2ccccn2)cc(OC)c1OC |
| InChI | InChI=1S/C28H27ClN2O7/c1-15-10-18(26(37-4)19(29)11-15)24(32)22-23(16-12-20(35-2)27(38-5)21(13-16)36-3)31(28(34)25(22)33)14-17-8-6-7-9-30-17/h6-13,23,32H,14H2,1-5H3/b24-22+ |
| InChIKey | OAOAGZOVGMLODS-ZNTNEXAZSA-N |
| XLogP | 4.70 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|