C24H26N2O3 — CID 108631115
1-cyclohexyl-4-hydroxy-3-(3-phenylpropanoyl)-2-pyridin-3-yl-2H-pyrrol-5-one (PubChem CID 108631115) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-cyclohexyl-4-hydroxy-3-(3-phenylpropanoyl)-2-pyridin-3-yl-2H-pyrrol-5-one.
| Compound Name | 1-cyclohexyl-4-hydroxy-3-(3-phenylpropanoyl)-2-pyridin-3-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108631115 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-cyclohexyl-4-hydroxy-3-(3-phenylpropanoyl)-2-pyridin-3-yl-2H-pyrrol-5-one |
| SMILES | O=C(CCc1ccccc1)C1=C(O)C(=O)N(C2CCCCC2)C1c1cccnc1 |
| InChI | InChI=1S/C24H26N2O3/c27-20(14-13-17-8-3-1-4-9-17)21-22(18-10-7-15-25-16-18)26(24(29)23(21)28)19-11-5-2-6-12-19/h1,3-4,7-10,15-16,19,22,28H,2,5-6,11-14H2 |
| InChIKey | KZTBYSLBKAMARA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |